C28H18F4S2 — CID 148886598
2-methyl-5-phenyl-3-[2,3,4,5-tetrafluoro-6-(2-methyl-5-phenylthiophen-3-yl)phenyl]thiophene (PubChem CID 148886598) has the molecular formula C28H18F4S2 and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-methyl-5-phenyl-3-[2,3,4,5-tetrafluoro-6-(2-methyl-5-phenylthiophen-3-yl)phenyl]thiophene.
| Compound Name | 2-methyl-5-phenyl-3-[2,3,4,5-tetrafluoro-6-(2-methyl-5-phenylthiophen-3-yl)phenyl]thiophene |
|---|---|
| PubChem CID | 148886598 |
| Molecular Formula | C28H18F4S2 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 2-methyl-5-phenyl-3-[2,3,4,5-tetrafluoro-6-(2-methyl-5-phenylthiophen-3-yl)phenyl]thiophene |
| SMILES | Cc1sc(-c2ccccc2)cc1-c1c(F)c(F)c(F)c(F)c1-c1cc(-c2ccccc2)sc1C |
| InChI | InChI=1S/C28H18F4S2/c1-15-19(13-21(33-15)17-9-5-3-6-10-17)23-24(26(30)28(32)27(31)25(23)29)20-14-22(34-16(20)2)18-11-7-4-8-12-18/h3-14H,1-2H3 |
| InChIKey | PECFXCFTBCIUQS-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|