About benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate
benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate (PubChem CID 14888684) has the molecular formula C24H27F2NO5
and a molecular weight of 447.48 g/mol. Its IUPAC name is benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate.
Molecular Properties
| Compound Name | benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate |
| PubChem CID | 14888684 |
| Molecular Formula | C24H27F2NO5 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate |
| SMILES | CC(=O)NC(Cc1ccc(C(F)(F)C(=O)OC(C)(C)C)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H27F2NO5/c1-16(28)27-20(21(29)31-15-18-8-6-5-7-9-18)14-17-10-12-19(13-11-17)24(25,26)22(30)32-23(2,3)4/h5-13,20H,14-15H2,1-4H3,(H,27,28) |
| InChIKey | KYVSCTVXMAELFM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate?
The IUPAC name of benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate (CID 14888684) is benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate.
What is the SMILES notation for benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate?
The canonical SMILES for benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate is CC(=O)NC(Cc1ccc(C(F)(F)C(=O)OC(C)(C)C)cc1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate?
The InChIKey is KYVSCTVXMAELFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27F2NO5/c1-16(28)27-20(21(29)31-15-18-8-6-5-7-9-18)14-17-10-12-19(13-11-17)24(25,26)22(30)32-23(2,3)4/h5-13,20H,14-15H2,1-4H3,(H,27,28).
What are the key properties of benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate?
benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate has a molecular weight of 447.48 g/mol, XLogP of 3.91, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-acetamido-3-[4-[1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]propanoate is sourced from PubChem (CID 14888684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).