C29H25ClN4O2 — CID 148890461
N-(5-chloro-2-pyridinyl)-2-[2-[4-[2-(N,N-dimethylcarbamimidoyl)phenyl]phenyl]-2-oxoethyl]benzamide (PubChem CID 148890461) has the molecular formula C29H25ClN4O2 and a molecular weight of 497.00 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-[4-[2-(N,N-dimethylcarbamimidoyl)phenyl]phenyl]-2-oxoethyl]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-[2-(N,N-dimethylcarbamimidoyl)phenyl]phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 148890461 |
| Molecular Formula | C29H25ClN4O2 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-[2-(N,N-dimethylcarbamimidoyl)phenyl]phenyl]-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(/c1ccccc1-c1ccc(C(=O)Cc2ccccc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C29H25ClN4O2/c1-34(2)28(31)25-10-6-5-8-23(25)19-11-13-20(14-12-19)26(35)17-21-7-3-4-9-24(21)29(36)33-27-16-15-22(30)18-32-27/h3-16,18,31H,17H2,1-2H3,(H,32,33,36)/b31-28- |
| InChIKey | PEUYNMRFWWSOSX-PNOGMODKSA-N |
| XLogP | 5.97 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|