C26H12F4N2O4 — CID 148891967
11,14,22,26-tetrafluoro-19-hydroxy-7,18-dimethyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17-trione (PubChem CID 148891967) has the molecular formula C26H12F4N2O4 and a molecular weight of 492.38 g/mol. Its IUPAC name is 11,14,22,26-tetrafluoro-19-hydroxy-7,18-dimethyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17-trione.
| Compound Name | 11,14,22,26-tetrafluoro-19-hydroxy-7,18-dimethyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17-trione |
|---|---|
| PubChem CID | 148891967 |
| Molecular Formula | C26H12F4N2O4 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 11,14,22,26-tetrafluoro-19-hydroxy-7,18-dimethyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17-trione |
| SMILES | CN1C(=O)c2cc(F)c3c4c(F)cc5c6c(cc(F)c(c7c(F)cc(c2c37)C1=O)c64)C(O)N(C)C5=O |
| InChI | InChI=1S/C26H12F4N2O4/c1-31-23(33)7-3-11(27)17-19-13(29)5-9-16-10(26(36)32(2)25(9)35)6-14(30)20(22(16)19)18-12(28)4-8(24(31)34)15(7)21(17)18/h3-6,23,33H,1-2H3 |
| InChIKey | PFCPGFASRWGMBA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|