C18H22FN5O — CID 148892673
(3-amino-6-ethyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 148892673) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is (3-amino-6-ethyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | (3-amino-6-ethyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 148892673 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (3-amino-6-ethyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | CCN1CCc2c(nn(C(=O)C3CCNc4ccc(F)cc43)c2N)C1 |
| InChI | InChI=1S/C18H22FN5O/c1-2-23-8-6-13-16(10-23)22-24(17(13)20)18(25)12-5-7-21-15-4-3-11(19)9-14(12)15/h3-4,9,12,21H,2,5-8,10,20H2,1H3 |
| InChIKey | PFFZJHNRGQEDJD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |