C20H22N6O2S — CID 148895181
5-methoxy-2-methyl-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3H-1,2-benzothiazole-6-carboxamide (PubChem CID 148895181) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is 5-methoxy-2-methyl-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3H-1,2-benzothiazole-6-carboxamide.
| Compound Name | 5-methoxy-2-methyl-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3H-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 148895181 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 5-methoxy-2-methyl-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3H-1,2-benzothiazole-6-carboxamide |
| SMILES | COc1cc2c(cc1C(=O)Nc1cccc(-c3nncn3C(C)C)n1)SN(C)C2 |
| InChI | InChI=1S/C20H22N6O2S/c1-12(2)26-11-21-24-19(26)15-6-5-7-18(22-15)23-20(27)14-9-17-13(8-16(14)28-4)10-25(3)29-17/h5-9,11-12H,10H2,1-4H3,(H,22,23,27) |
| InChIKey | PFSJFILDYZPBDB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|