C12H15ClN2 — CID 148896060
2-tert-butyl-4-chloro-1-methylpyrrolo[2,3-c]pyridine (PubChem CID 148896060) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-1-methylpyrrolo[2,3-c]pyridine.
| Compound Name | 2-tert-butyl-4-chloro-1-methylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 148896060 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-tert-butyl-4-chloro-1-methylpyrrolo[2,3-c]pyridine |
| SMILES | Cn1c(C(C)(C)C)cc2c(Cl)cncc21 |
| InChI | InChI=1S/C12H15ClN2/c1-12(2,3)11-5-8-9(13)6-14-7-10(8)15(11)4/h5-7H,1-4H3 |
| InChIKey | PFWPLTYYKOIJGT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |