About 1,3-thiazol-5-ylmethyl 3-methylbenzoate
1,3-thiazol-5-ylmethyl 3-methylbenzoate (PubChem CID 1488964) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl 3-methylbenzoate.
Molecular Properties
| Compound Name | 1,3-thiazol-5-ylmethyl 3-methylbenzoate |
| PubChem CID | 1488964 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCc2cncs2)c1 |
| InChI | InChI=1S/C12H11NO2S/c1-9-3-2-4-10(5-9)12(14)15-7-11-6-13-8-16-11/h2-6,8H,7H2,1H3 |
| InChIKey | GGNPJPIGEHRXLV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-thiazol-5-ylmethyl 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-ylmethyl 3-methylbenzoate?
The IUPAC name of 1,3-thiazol-5-ylmethyl 3-methylbenzoate (CID 1488964) is 1,3-thiazol-5-ylmethyl 3-methylbenzoate.
What is the SMILES notation for 1,3-thiazol-5-ylmethyl 3-methylbenzoate?
The canonical SMILES for 1,3-thiazol-5-ylmethyl 3-methylbenzoate is Cc1cccc(C(=O)OCc2cncs2)c1.
What is the InChIKey of 1,3-thiazol-5-ylmethyl 3-methylbenzoate?
The InChIKey is GGNPJPIGEHRXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c1-9-3-2-4-10(5-9)12(14)15-7-11-6-13-8-16-11/h2-6,8H,7H2,1H3.
What are the key properties of 1,3-thiazol-5-ylmethyl 3-methylbenzoate?
1,3-thiazol-5-ylmethyl 3-methylbenzoate has a molecular weight of 233.29 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-ylmethyl 3-methylbenzoate is sourced from PubChem (CID 1488964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).