About (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate
(4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate (PubChem CID 14890283) has the molecular formula C21H20O7
and a molecular weight of 384.38 g/mol. Its IUPAC name is (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate.
Molecular Properties
| Compound Name | (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate |
| PubChem CID | 14890283 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate |
| SMILES | O=C(OCC1(O)C=CC(OC(=O)c2ccccc2)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C21H20O7/c22-17-16(28-20(25)15-9-5-2-6-10-15)11-12-21(26,18(17)23)13-27-19(24)14-7-3-1-4-8-14/h1-12,16-18,22-23,26H,13H2 |
| InChIKey | PCFGXGDGOLIQTE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate?
The IUPAC name of (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate (CID 14890283) is (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate.
What is the SMILES notation for (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate?
The canonical SMILES for (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate is O=C(OCC1(O)C=CC(OC(=O)c2ccccc2)C(O)C1O)c1ccccc1.
What is the InChIKey of (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate?
The InChIKey is PCFGXGDGOLIQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O7/c22-17-16(28-20(25)15-9-5-2-6-10-15)11-12-21(26,18(17)23)13-27-19(24)14-7-3-1-4-8-14/h1-12,16-18,22-23,26H,13H2.
What are the key properties of (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate?
(4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate has a molecular weight of 384.38 g/mol, XLogP of 1.09, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzoyloxy-1,5,6-trihydroxycyclohex-2-en-1-yl)methyl benzoate is sourced from PubChem (CID 14890283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).