About 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol
4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol (PubChem CID 14890287) has the molecular formula C13H10OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol |
| PubChem CID | 14890287 |
| Molecular Formula | C13H10OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol |
| SMILES | CC#CC#Cc1ccc(C#CCCO)s1 |
| InChI | InChI=1S/C13H10OS/c1-2-3-4-7-12-9-10-13(15-12)8-5-6-11-14/h9-10,14H,6,11H2,1H3 |
| InChIKey | DGRYPUZVMYTRRW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol?
The IUPAC name of 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol (CID 14890287) is 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol.
What is the SMILES notation for 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol?
The canonical SMILES for 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol is CC#CC#Cc1ccc(C#CCCO)s1.
What is the InChIKey of 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol?
The InChIKey is DGRYPUZVMYTRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS/c1-2-3-4-7-12-9-10-13(15-12)8-5-6-11-14/h9-10,14H,6,11H2,1H3.
What are the key properties of 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol?
4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol has a molecular weight of 214.29 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-1-ol is sourced from PubChem (CID 14890287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).