C26H23N3O4 — CID 148902932
ethyl 4-[3-[(Z)-4-(2-methoxyphenyl)-2-oxobut-3-enyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 148902932) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is ethyl 4-[3-[(Z)-4-(2-methoxyphenyl)-2-oxobut-3-enyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[3-[(Z)-4-(2-methoxyphenyl)-2-oxobut-3-enyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 148902932 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | ethyl 4-[3-[(Z)-4-(2-methoxyphenyl)-2-oxobut-3-enyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ncnc(-c3cccc(CC(=O)/C=C\c4ccccc4OC)c3)c12 |
| InChI | InChI=1S/C26H23N3O4/c1-3-33-26(31)21-15-27-25-23(21)24(28-16-29-25)19-9-6-7-17(13-19)14-20(30)12-11-18-8-4-5-10-22(18)32-2/h4-13,15-16H,3,14H2,1-2H3,(H,27,28,29)/b12-11- |
| InChIKey | PHDLUXZVUSARGM-QXMHVHEDSA-N |
| XLogP | 4.64 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|