C15H24O3 — CID 14890372
(4S,4aR,6R,7R,8S,8aS)-7,8-dihydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 14890372) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (4S,4aR,6R,7R,8S,8aS)-7,8-dihydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (4S,4aR,6R,7R,8S,8aS)-7,8-dihydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 14890372 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (4S,4aR,6R,7R,8S,8aS)-7,8-dihydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | C=C(C)[C@H]1C[C@@]2(C)[C@H](CC(=O)C[C@@H]2C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H24O3/c1-8(2)11-7-15(4)9(3)5-10(16)6-12(15)14(18)13(11)17/h9,11-14,17-18H,1,5-7H2,2-4H3/t9-,11+,12+,13+,14-,15+/m0/s1 |
| InChIKey | YXAAITDACDFQGY-DXSVJQKISA-N |
| XLogP | 1.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|