C22H28BrN5O2 — CID 148903788
tert-butyl N-[(3S)-1-[3-[1-(6-bromo-2-pyridinyl)ethenylamino]-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 148903788) has the molecular formula C22H28BrN5O2 and a molecular weight of 474.40 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[3-[1-(6-bromo-2-pyridinyl)ethenylamino]-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[3-[1-(6-bromo-2-pyridinyl)ethenylamino]-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 148903788 |
| Molecular Formula | C22H28BrN5O2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | tert-butyl N-[(3S)-1-[3-[1-(6-bromo-2-pyridinyl)ethenylamino]-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | C=C(Nc1cnccc1N1CCC[C@H](NC(=O)OC(C)(C)C)C1)c1cccc(Br)n1 |
| InChI | InChI=1S/C22H28BrN5O2/c1-15(17-8-5-9-20(23)27-17)25-18-13-24-11-10-19(18)28-12-6-7-16(14-28)26-21(29)30-22(2,3)4/h5,8-11,13,16,25H,1,6-7,12,14H2,2-4H3,(H,26,29)/t16-/m0/s1 |
| InChIKey | PHHMPMANVRCJGZ-INIZCTEOSA-N |
| XLogP | 4.82 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|