About 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one
1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one (PubChem CID 148907812) has the molecular formula C23H30O2
and a molecular weight of 338.49 g/mol. Its IUPAC name is 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one.
Molecular Properties
| Compound Name | 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one |
| PubChem CID | 148907812 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one |
| SMILES | Cc1ccc(COc2cc(C)c(CC(=O)CC(C)(C)C)c(C)c2)cc1 |
| InChI | InChI=1S/C23H30O2/c1-16-7-9-19(10-8-16)15-25-21-11-17(2)22(18(3)12-21)13-20(24)14-23(4,5)6/h7-12H,13-15H2,1-6H3 |
| InChIKey | PIAPBHYKRGZZLF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one?
The IUPAC name of 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one (CID 148907812) is 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one.
What is the SMILES notation for 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one?
The canonical SMILES for 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one is Cc1ccc(COc2cc(C)c(CC(=O)CC(C)(C)C)c(C)c2)cc1.
What is the InChIKey of 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one?
The InChIKey is PIAPBHYKRGZZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O2/c1-16-7-9-19(10-8-16)15-25-21-11-17(2)22(18(3)12-21)13-20(24)14-23(4,5)6/h7-12H,13-15H2,1-6H3.
What are the key properties of 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one?
1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one has a molecular weight of 338.49 g/mol, XLogP of 5.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-dimethyl-4-[(4-methylphenyl)methoxy]phenyl]-4,4-dimethylpentan-2-one is sourced from PubChem (CID 148907812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).