C20H16O4 — CID 148909136
6,15-dihydroxy-2,11-dimethylpentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12(17),13,15-hexaene-9,18-dione (PubChem CID 148909136) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 6,15-dihydroxy-2,11-dimethylpentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12(17),13,15-hexaene-9,18-dione.
| Compound Name | 6,15-dihydroxy-2,11-dimethylpentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12(17),13,15-hexaene-9,18-dione |
|---|---|
| PubChem CID | 148909136 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 6,15-dihydroxy-2,11-dimethylpentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12(17),13,15-hexaene-9,18-dione |
| SMILES | CC12c3ccc(O)cc3C(=O)C1C1(C)c3ccc(O)cc3C(=O)C21 |
| InChI | InChI=1S/C20H16O4/c1-19-13-5-3-9(21)7-11(13)15(23)17(19)20(2)14-6-4-10(22)8-12(14)16(24)18(19)20/h3-8,17-18,21-22H,1-2H3 |
| InChIKey | PIGYYDBUDRVFAB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |