About 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol
6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol (PubChem CID 148909285) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 148909285 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)(C)C1=CC(n2nc3ccccc3n2)C(O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C20H27N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,17-18,24H,1-6H3 |
| InChIKey | PIHQEDSRZMDADQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol (CID 148909285) is 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol is CC(C)(C)C1=CC(n2nc3ccccc3n2)C(O)C(C(C)(C)C)=C1.
What is the InChIKey of 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol?
The InChIKey is PIHQEDSRZMDADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,17-18,24H,1-6H3.
What are the key properties of 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol?
6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol has a molecular weight of 325.46 g/mol, XLogP of 4.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzotriazol-2-yl)-2,4-ditert-butylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 148909285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).