2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide

C40H26N2O2S — CID 148909882

IUPAC2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide
SMILESO=S1(=O)C(c2ccc(-n3c4ccccc4c4ccccc43)cc2)=CC=C1c1ccc(-n2c3ccccc3c3ccccc32)cc1
InChIInChI=1S/C40H26N2O2S/c43-45(44)39(27-17-21-29(22-18-27)41-35-13-5-1-9-31(35)32-10-2-6-14-36(32)41)25-26-40(45)28-19-23-30(24-20-28)42-37-15-7-3-11-33(37)34-12-4-8-16-38(34)42/h1-26H
InChIKeyPIKNPQBAXQNARF-UHFFFAOYSA-N
MW598.73 g/mol
LogP9.69
Rot. Bonds4

About 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide

2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide (PubChem CID 148909882) has the molecular formula C40H26N2O2S and a molecular weight of 598.73 g/mol. Its IUPAC name is 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide.

Molecular Properties

Compound Name2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide
PubChem CID148909882
Molecular FormulaC40H26N2O2S
Molecular Weight598.73 g/mol
Exact Mass598.17
IUPAC Name2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide
SMILESO=S1(=O)C(c2ccc(-n3c4ccccc4c4ccccc43)cc2)=CC=C1c1ccc(-n2c3ccccc3c3ccccc32)cc1
InChIInChI=1S/C40H26N2O2S/c43-45(44)39(27-17-21-29(22-18-27)41-35-13-5-1-9-31(35)32-10-2-6-14-36(32)41)25-26-40(45)28-19-23-30(24-20-28)42-37-15-7-3-11-33(37)34-12-4-8-16-38(34)42/h1-26H
InChIKeyPIKNPQBAXQNARF-UHFFFAOYSA-N
XLogP9.69
TPSA44.00 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms45
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500598.73
LogP ≤ 59.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide?
The IUPAC name of 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide (CID 148909882) is 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide.
What is the SMILES notation for 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide?
The canonical SMILES for 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide is O=S1(=O)C(c2ccc(-n3c4ccccc4c4ccccc43)cc2)=CC=C1c1ccc(-n2c3ccccc3c3ccccc32)cc1.
What is the InChIKey of 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide?
The InChIKey is PIKNPQBAXQNARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H26N2O2S/c43-45(44)39(27-17-21-29(22-18-27)41-35-13-5-1-9-31(35)32-10-2-6-14-36(32)41)25-26-40(45)28-19-23-30(24-20-28)42-37-15-7-3-11-33(37)34-12-4-8-16-38(34)42/h1-26H.
What are the key properties of 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide?
2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide has a molecular weight of 598.73 g/mol, XLogP of 9.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-carbazol-9-ylphenyl)thiophene 1,1-dioxide is sourced from PubChem (CID 148909882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).