C27H20ClFN4OS — CID 148910137
(5aR,6R,9aS)-1-(6-chloro-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 148910137) has the molecular formula C27H20ClFN4OS and a molecular weight of 503.00 g/mol. Its IUPAC name is (5aR,6R,9aS)-1-(6-chloro-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-1-(6-chloro-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 148910137 |
| Molecular Formula | C27H20ClFN4OS |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (5aR,6R,9aS)-1-(6-chloro-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4ccccc4F)nn3-c3nc4ccc(Cl)cc4s3)CC[C@H]12 |
| InChI | InChI=1S/C27H20ClFN4OS/c1-14-19-9-8-18-23(17-5-3-4-6-20(17)29)32-33(25(18)27(19,2)12-15(13-30)24(14)34)26-31-21-10-7-16(28)11-22(21)35-26/h3-7,10-12,14,19H,8-9H2,1-2H3/t14-,19-,27-/m1/s1 |
| InChIKey | PILUIQKCJINJMB-FHNDPDEWSA-N |
| XLogP | 6.43 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |