C22H24N2O3 — CID 14891386
5-[4-methoxy-3-[[(1S,8S,9S)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]oxy]phenyl]-1-methylimidazolidin-2-one (PubChem CID 14891386) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-[4-methoxy-3-[[(1S,8S,9S)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]oxy]phenyl]-1-methylimidazolidin-2-one.
| Compound Name | 5-[4-methoxy-3-[[(1S,8S,9S)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]oxy]phenyl]-1-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 14891386 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 5-[4-methoxy-3-[[(1S,8S,9S)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]oxy]phenyl]-1-methylimidazolidin-2-one |
| SMILES | COc1ccc(C2CNC(=O)N2C)cc1O[C@H]1C[C@@H]2C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C22H24N2O3/c1-24-18(12-23-22(24)25)13-7-8-19(26-2)21(10-13)27-20-11-14-9-17(20)16-6-4-3-5-15(14)16/h3-8,10,14,17-18,20H,9,11-12H2,1-2H3,(H,23,25)/t14-,17-,18?,20-/m0/s1 |
| InChIKey | CCNUQTMMRGAWTF-KWAWZILWSA-N |
| XLogP | 3.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |