C19H23NO3S — CID 14891561
5-(spiro[3,4-dihydrochromene-2,1'-cycloheptane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 14891561) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 5-(spiro[3,4-dihydrochromene-2,1'-cycloheptane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(spiro[3,4-dihydrochromene-2,1'-cycloheptane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 14891561 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 5-(spiro[3,4-dihydrochromene-2,1'-cycloheptane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc3c(c2)CCC2(CCCCCC2)O3)S1 |
| InChI | InChI=1S/C19H23NO3S/c21-17-16(24-18(22)20-17)12-13-5-6-15-14(11-13)7-10-19(23-15)8-3-1-2-4-9-19/h5-6,11,16H,1-4,7-10,12H2,(H,20,21,22) |
| InChIKey | IHLBBMFEGKIFIH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|