C17H19NO3S — CID 14891564
5-(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 14891564) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 5-(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 14891564 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 5-(spiro[3,4-dihydrochromene-2,1'-cyclopentane]-6-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc3c(c2)CCC2(CCCC2)O3)S1 |
| InChI | InChI=1S/C17H19NO3S/c19-15-14(22-16(20)18-15)10-11-3-4-13-12(9-11)5-8-17(21-13)6-1-2-7-17/h3-4,9,14H,1-2,5-8,10H2,(H,18,19,20) |
| InChIKey | GXAMVGGHEXSPTP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|