C16H34O3S2Si — CID 14891734
(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,4-diol (PubChem CID 14891734) has the molecular formula C16H34O3S2Si and a molecular weight of 366.67 g/mol. Its IUPAC name is (1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,4-diol.
| Compound Name | (1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,4-diol |
|---|---|
| PubChem CID | 14891734 |
| Molecular Formula | C16H34O3S2Si |
| Molecular Weight | 366.67 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,4-diol |
| SMILES | CC(C)(CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C16H34O3S2Si/c1-15(2,3)22(6,7)19-13(16(4,5)11-17)12(18)14-20-9-8-10-21-14/h12-14,17-18H,8-11H2,1-7H3/t12-,13+/m1/s1 |
| InChIKey | BTGRWBHLJBGKCZ-OLZOCXBDSA-N |
| XLogP | 3.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|