C13H13N3OS — CID 14892077
1-(3-amino-11-ethyl-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)ethanone (PubChem CID 14892077) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-(3-amino-11-ethyl-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)ethanone.
| Compound Name | 1-(3-amino-11-ethyl-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)ethanone |
|---|---|
| PubChem CID | 14892077 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(3-amino-11-ethyl-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)ethanone |
| SMILES | CCc1ccn2nc3sc(C(C)=O)c(N)c3c2c1 |
| InChI | InChI=1S/C13H13N3OS/c1-3-8-4-5-16-9(6-8)10-11(14)12(7(2)17)18-13(10)15-16/h4-6H,3,14H2,1-2H3 |
| InChIKey | GVHMKVQKANEHDK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |