C16H11N3OS — CID 14892081
(3-amino-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)-phenylmethanone (PubChem CID 14892081) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is (3-amino-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)-phenylmethanone.
| Compound Name | (3-amino-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 14892081 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | (3-amino-5-thia-7,8-diazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-4-yl)-phenylmethanone |
| SMILES | Nc1c(C(=O)c2ccccc2)sc2nn3ccccc3c12 |
| InChI | InChI=1S/C16H11N3OS/c17-13-12-11-8-4-5-9-19(11)18-16(12)21-15(13)14(20)10-6-2-1-3-7-10/h1-9H,17H2 |
| InChIKey | ADPOGEYBYPLHHU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |