About CID 148922193
CID 148922193 (PubChem CID 148922193) has the molecular formula C5H11IN-
and a molecular weight of 212.05 g/mol.
Molecular Properties
| Compound Name | CID 148922193 |
| PubChem CID | 148922193 |
| Molecular Formula | C5H11IN- |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | — |
| SMILES | CNC1(C)C[I-]C1 |
| InChI | InChI=1S/C5H11IN/c1-5(7-2)3-6-4-5/h7H,3-4H2,1-2H3/q-1 |
| InChIKey | HYCGOJFQWXLILM-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 148922193 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 148922193?
The IUPAC name of CID 148922193 (CID 148922193) is not available.
What is the SMILES notation for CID 148922193?
The canonical SMILES for CID 148922193 is CNC1(C)C[I-]C1.
What is the InChIKey of CID 148922193?
The InChIKey is HYCGOJFQWXLILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11IN/c1-5(7-2)3-6-4-5/h7H,3-4H2,1-2H3/q-1.
What are the key properties of CID 148922193?
CID 148922193 has a molecular weight of 212.05 g/mol, XLogP of -2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 148922193 is sourced from PubChem (CID 148922193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).