About 2-(4-azidophenyl)ethanol
2-(4-azidophenyl)ethanol (PubChem CID 14892433) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-(4-azidophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(4-azidophenyl)ethanol |
| PubChem CID | 14892433 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-(4-azidophenyl)ethanol |
| SMILES | [N-]=[N+]=Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C8H9N3O/c9-11-10-8-3-1-7(2-4-8)5-6-12/h1-4,12H,5-6H2 |
| InChIKey | NASVKGVQQLAHPV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-azidophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-azidophenyl)ethanol?
The IUPAC name of 2-(4-azidophenyl)ethanol (CID 14892433) is 2-(4-azidophenyl)ethanol.
What is the SMILES notation for 2-(4-azidophenyl)ethanol?
The canonical SMILES for 2-(4-azidophenyl)ethanol is [N-]=[N+]=Nc1ccc(CCO)cc1.
What is the InChIKey of 2-(4-azidophenyl)ethanol?
The InChIKey is NASVKGVQQLAHPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-11-10-8-3-1-7(2-4-8)5-6-12/h1-4,12H,5-6H2.
What are the key properties of 2-(4-azidophenyl)ethanol?
2-(4-azidophenyl)ethanol has a molecular weight of 163.18 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-azidophenyl)ethanol is sourced from PubChem (CID 14892433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).