C19H19NO2 — CID 14892681
9-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole (PubChem CID 14892681) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 9-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole.
| Compound Name | 9-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole |
|---|---|
| PubChem CID | 14892681 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 9-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole |
| SMILES | COc1ccc2c(c1)[nH]c1c3c(c(C)cc12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C19H19NO2/c1-11-9-15-13-6-5-12(21-4)10-16(13)20-17(15)14-7-8-19(2,3)22-18(11)14/h5-10,20H,1-4H3 |
| InChIKey | GDQWCFKJPYSDDG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |