About (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine
(2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine (PubChem CID 148927016) has the molecular formula C9H18FN
and a molecular weight of 159.25 g/mol. Its IUPAC name is (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine.
Molecular Properties
| Compound Name | (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine |
| PubChem CID | 148927016 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine |
| SMILES | C[C@@H]1[C@@H](C)CCCN1CCF |
| InChI | InChI=1S/C9H18FN/c1-8-4-3-6-11(7-5-10)9(8)2/h8-9H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | PLEKHUOTZVPMRZ-DTWKUNHWSA-N |
| XLogP | 2.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine?
The IUPAC name of (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine (CID 148927016) is (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine.
What is the SMILES notation for (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine?
The canonical SMILES for (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine is C[C@@H]1[C@@H](C)CCCN1CCF.
What is the InChIKey of (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine?
The InChIKey is PLEKHUOTZVPMRZ-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H18FN/c1-8-4-3-6-11(7-5-10)9(8)2/h8-9H,3-7H2,1-2H3/t8-,9+/m0/s1.
What are the key properties of (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine?
(2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine has a molecular weight of 159.25 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-1-(2-fluoroethyl)-2,3-dimethylpiperidine is sourced from PubChem (CID 148927016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).