C20H21FN4O4S — CID 148932275
[(3S)-3-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxymethyl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone (PubChem CID 148932275) has the molecular formula C20H21FN4O4S and a molecular weight of 432.48 g/mol. Its IUPAC name is [(3S)-3-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxymethyl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone.
| Compound Name | [(3S)-3-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxymethyl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 148932275 |
| Molecular Formula | C20H21FN4O4S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [(3S)-3-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxymethyl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone |
| SMILES | NC1=NS(=O)(=O)Cc2cccc(OC[C@H]3CCCN(C(=O)c4ccnc(F)c4)C3)c21 |
| InChI | InChI=1S/C20H21FN4O4S/c21-17-9-14(6-7-23-17)20(26)25-8-2-3-13(10-25)11-29-16-5-1-4-15-12-30(27,28)24-19(22)18(15)16/h1,4-7,9,13H,2-3,8,10-12H2,(H2,22,24)/t13-/m0/s1 |
| InChIKey | PMECWAMFTLRJFU-ZDUSSCGKSA-N |
| XLogP | 1.70 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|