About 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one
2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one (PubChem CID 14893475) has the molecular formula C9H9NO4
and a molecular weight of 195.17 g/mol. Its IUPAC name is 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one |
| PubChem CID | 14893475 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)OC(O)C(=O)N2O |
| InChI | InChI=1S/C9H9NO4/c1-5-2-3-6-7(4-5)14-9(12)8(11)10(6)13/h2-4,9,12-13H,1H3 |
| InChIKey | RMZOYFPXRODTKS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one?
The IUPAC name of 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one (CID 14893475) is 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one?
The canonical SMILES for 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one is Cc1ccc2c(c1)OC(O)C(=O)N2O.
What is the InChIKey of 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one?
The InChIKey is RMZOYFPXRODTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4/c1-5-2-3-6-7(4-5)14-9(12)8(11)10(6)13/h2-4,9,12-13H,1H3.
What are the key properties of 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one?
2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one has a molecular weight of 195.17 g/mol, XLogP of 0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-7-methyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 14893475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).