C14H12O2 — CID 14893582
tetracyclo[6.2.2.23,6.02,7]tetradeca-9,11,13-triene-4,5-dione (PubChem CID 14893582) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is tetracyclo[6.2.2.23,6.02,7]tetradeca-9,11,13-triene-4,5-dione.
| Compound Name | tetracyclo[6.2.2.23,6.02,7]tetradeca-9,11,13-triene-4,5-dione |
|---|---|
| PubChem CID | 14893582 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | tetracyclo[6.2.2.23,6.02,7]tetradeca-9,11,13-triene-4,5-dione |
| SMILES | O=C1C(=O)C2C=CC1C1C3C=CC(C=C3)C21 |
| InChI | InChI=1S/C14H12O2/c15-13-9-5-6-10(14(13)16)12-8-2-1-7(3-4-8)11(9)12/h1-12H |
| InChIKey | HTTOMZNEEDPJSC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|