About (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide
(3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide (PubChem CID 14893646) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide.
Molecular Properties
| Compound Name | (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide |
| PubChem CID | 14893646 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide |
| SMILES | CC(C)N1CCS/C1=N\C#N |
| InChI | InChI=1S/C7H11N3S/c1-6(2)10-3-4-11-7(10)9-5-8/h6H,3-4H2,1-2H3/b9-7- |
| InChIKey | ZYCCTLMGSXRKKZ-CLFYSBASSA-N |
| XLogP | 1.28 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide?
The IUPAC name of (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide (CID 14893646) is (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide.
What is the SMILES notation for (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide?
The canonical SMILES for (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide is CC(C)N1CCS/C1=N\C#N.
What is the InChIKey of (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide?
The InChIKey is ZYCCTLMGSXRKKZ-CLFYSBASSA-N. The full InChI is InChI=1S/C7H11N3S/c1-6(2)10-3-4-11-7(10)9-5-8/h6H,3-4H2,1-2H3/b9-7-.
What are the key properties of (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide?
(3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide has a molecular weight of 169.25 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-yl-1,3-thiazolidin-2-ylidene)cyanamide is sourced from PubChem (CID 14893646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).