C17H25ClN5O7P — CID 148937320
1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid (PubChem CID 148937320) has the molecular formula C17H25ClN5O7P and a molecular weight of 477.84 g/mol. Its IUPAC name is 1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid.
| Compound Name | 1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 148937320 |
| Molecular Formula | C17H25ClN5O7P |
| Molecular Weight | 477.84 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid |
| SMILES | CC(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C17H25ClN5O7P/c1-8(31(26,27)28)29-7-11-12(24)13(25)16(30-11)23-15-10(6-19-23)14(21-17(18)22-15)20-9-4-2-3-5-9/h6,8-9,11-13,16,24-25H,2-5,7H2,1H3,(H,20,21,22)(H2,26,27,28)/t8?,11-,12-,13-,16-/m1/s1 |
| InChIKey | PNFBXEASENQIGI-JQGYAOAWSA-N |
| XLogP | 0.99 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.84 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|