C12H20O2 — CID 14893868
3-hydroxy-3,7,7-trimethylnona-1,8-dien-5-one (PubChem CID 14893868) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-hydroxy-3,7,7-trimethylnona-1,8-dien-5-one.
| Compound Name | 3-hydroxy-3,7,7-trimethylnona-1,8-dien-5-one |
|---|---|
| PubChem CID | 14893868 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 3-hydroxy-3,7,7-trimethylnona-1,8-dien-5-one |
| SMILES | C=CC(C)(C)CC(=O)CC(C)(O)C=C |
| InChI | InChI=1S/C12H20O2/c1-6-11(3,4)8-10(13)9-12(5,14)7-2/h6-7,14H,1-2,8-9H2,3-5H3 |
| InChIKey | VLDDKWHISIMJGU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|