C12H20O — CID 14893900
3,3,7a-trimethyl-2,3a,4,5-tetrahydro-1H-inden-1-ol (PubChem CID 14893900) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 3,3,7a-trimethyl-2,3a,4,5-tetrahydro-1H-inden-1-ol.
| Compound Name | 3,3,7a-trimethyl-2,3a,4,5-tetrahydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 14893900 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 3,3,7a-trimethyl-2,3a,4,5-tetrahydro-1H-inden-1-ol |
| SMILES | CC1(C)CC(O)C2(C)C=CCCC12 |
| InChI | InChI=1S/C12H20O/c1-11(2)8-10(13)12(3)7-5-4-6-9(11)12/h5,7,9-10,13H,4,6,8H2,1-3H3 |
| InChIKey | WLRKRRPMDUCIHO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|