About (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one
(2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one (PubChem CID 148942283) has the molecular formula C18H18O5
and a molecular weight of 314.34 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one |
| PubChem CID | 148942283 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccc(CO)o2)CCC/C1=C\c1ccc(CO)o1 |
| InChI | InChI=1S/C18H18O5/c19-10-16-6-4-14(22-16)8-12-2-1-3-13(18(12)21)9-15-5-7-17(11-20)23-15/h4-9,19-20H,1-3,10-11H2/b12-8+,13-9+ |
| InChIKey | PODJOMMVKFTPMO-QHKWOANTSA-N |
| XLogP | 3.08 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one?
The IUPAC name of (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one (CID 148942283) is (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one.
What is the SMILES notation for (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one?
The canonical SMILES for (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one is O=C1/C(=C/c2ccc(CO)o2)CCC/C1=C\c1ccc(CO)o1.
What is the InChIKey of (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one?
The InChIKey is PODJOMMVKFTPMO-QHKWOANTSA-N. The full InChI is InChI=1S/C18H18O5/c19-10-16-6-4-14(22-16)8-12-2-1-3-13(18(12)21)9-15-5-7-17(11-20)23-15/h4-9,19-20H,1-3,10-11H2/b12-8+,13-9+.
What are the key properties of (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one?
(2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one has a molecular weight of 314.34 g/mol, XLogP of 3.08, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-2,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]cyclohexan-1-one is sourced from PubChem (CID 148942283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).