C11H9F6N3O — CID 14894319
1-phenylmethoxy-5,5-bis(trifluoromethyl)-4H-triazole (PubChem CID 14894319) has the molecular formula C11H9F6N3O and a molecular weight of 313.20 g/mol. Its IUPAC name is 1-phenylmethoxy-5,5-bis(trifluoromethyl)-4H-triazole.
| Compound Name | 1-phenylmethoxy-5,5-bis(trifluoromethyl)-4H-triazole |
|---|---|
| PubChem CID | 14894319 |
| Molecular Formula | C11H9F6N3O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-phenylmethoxy-5,5-bis(trifluoromethyl)-4H-triazole |
| SMILES | FC(F)(F)C1(C(F)(F)F)CN=NN1OCc1ccccc1 |
| InChI | InChI=1S/C11H9F6N3O/c12-10(13,14)9(11(15,16)17)7-18-19-20(9)21-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | JHJKBADCWIWVFD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |