C18H27FN4O5S — CID 148944581
N-[(1R)-1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 148944581) has the molecular formula C18H27FN4O5S and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[(1R)-1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 148944581 |
| Molecular Formula | C18H27FN4O5S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[(1R)-1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1cc(F)c(OCC2CC2)[nH]1 |
| InChI | InChI=1S/C18H27FN4O5S/c1-12(15-9-14(19)17(20-15)28-11-13-5-6-13)22-29(26,27)8-4-2-3-7-23-10-16(24)21-18(23)25/h9,12-13,20,22H,2-8,10-11H2,1H3,(H,21,24,25)/t12-/m1/s1 |
| InChIKey | PORJAUSADQMAHQ-GFCCVEGCSA-N |
| XLogP | 1.65 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|