C31H25F5N4O2 — CID 148946242
5-[2-[(2R)-5-(5,5-difluoro-7-methyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 148946242) has the molecular formula C31H25F5N4O2 and a molecular weight of 580.56 g/mol. Its IUPAC name is 5-[2-[(2R)-5-(5,5-difluoro-7-methyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-5-(5,5-difluoro-7-methyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 148946242 |
| Molecular Formula | C31H25F5N4O2 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 5-[2-[(2R)-5-(5,5-difluoro-7-methyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | Cc1c2c(nn1CC(=O)C[C@@H](Cc1cc(F)cc(F)c1)c1ncccc1-c1ccc(F)c(C(N)=O)c1)C1CC1C2(F)F |
| InChI | InChI=1S/C31H25F5N4O2/c1-15-27-29(23-13-25(23)31(27,35)36)39-40(15)14-21(41)10-18(7-16-8-19(32)12-20(33)9-16)28-22(3-2-6-38-28)17-4-5-26(34)24(11-17)30(37)42/h2-6,8-9,11-12,18,23,25H,7,10,13-14H2,1H3,(H2,37,42)/t18-,23?,25?/m1/s1 |
| InChIKey | POZMKKOBDBIWNE-HYCNBMAASA-N |
| XLogP | 5.96 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |