C17H16F3N3O3 — CID 148949691
2-(6-morpholin-4-yl-4-oxo-3H-pyridin-2-yl)-N-(2,4,5-trifluorophenyl)acetamide (PubChem CID 148949691) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 2-(6-morpholin-4-yl-4-oxo-3H-pyridin-2-yl)-N-(2,4,5-trifluorophenyl)acetamide.
| Compound Name | 2-(6-morpholin-4-yl-4-oxo-3H-pyridin-2-yl)-N-(2,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 148949691 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-(6-morpholin-4-yl-4-oxo-3H-pyridin-2-yl)-N-(2,4,5-trifluorophenyl)acetamide |
| SMILES | O=C1C=C(N2CCOCC2)N=C(CC(=O)Nc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C17H16F3N3O3/c18-12-8-14(20)15(9-13(12)19)22-17(25)6-10-5-11(24)7-16(21-10)23-1-3-26-4-2-23/h7-9H,1-6H2,(H,22,25) |
| InChIKey | PPPPRWUADDTGHF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|