C34H32FN3O4S2 — CID 148950690
5-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one (PubChem CID 148950690) has the molecular formula C34H32FN3O4S2 and a molecular weight of 629.78 g/mol. Its IUPAC name is 5-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 148950690 |
| Molecular Formula | C34H32FN3O4S2 |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | 5-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=S)CC(=O)Cc5ccccc5OC)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C34H32FN3O4S2/c1-40-14-13-36-20-23-7-9-28(38-21-23)33-19-29-34(44-33)32(11-12-37-29)42-31-10-8-22(16-27(31)35)15-26(43)18-25(39)17-24-5-3-4-6-30(24)41-2/h3-12,16,19,21,36H,13-15,17-18,20H2,1-2H3 |
| InChIKey | PPWRJAZONPPTLD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|