C24H42FN7O2 — CID 148953528
3,3-diamino-2-(3-fluoro-6-methyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 148953528) has the molecular formula C24H42FN7O2 and a molecular weight of 479.65 g/mol. Its IUPAC name is 3,3-diamino-2-(3-fluoro-6-methyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(3-fluoro-6-methyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 148953528 |
| Molecular Formula | C24H42FN7O2 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | 3,3-diamino-2-(3-fluoro-6-methyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | CC12CCC(F)CN1C(C(C(=O)NC1CNCCC1N1CCN3C(=O)CCCC3C1)C(N)N)C2 |
| InChI | InChI=1S/C24H42FN7O2/c1-24-7-5-15(25)13-32(24)19(11-24)21(22(26)27)23(34)29-17-12-28-8-6-18(17)30-9-10-31-16(14-30)3-2-4-20(31)33/h15-19,21-22,28H,2-14,26-27H2,1H3,(H,29,34) |
| InChIKey | PQKFKUMUSATOSB-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|