C26H37NO2 — CID 148956256
1-[2-[2-methoxy-4-[(3S)-3-methyl-5-(4-methylphenyl)pentyl]phenoxy]ethyl]pyrrolidine (PubChem CID 148956256) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 1-[2-[2-methoxy-4-[(3S)-3-methyl-5-(4-methylphenyl)pentyl]phenoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[2-methoxy-4-[(3S)-3-methyl-5-(4-methylphenyl)pentyl]phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 148956256 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 1-[2-[2-methoxy-4-[(3S)-3-methyl-5-(4-methylphenyl)pentyl]phenoxy]ethyl]pyrrolidine |
| SMILES | COc1cc(CC[C@@H](C)CCc2ccc(C)cc2)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C26H37NO2/c1-21-6-10-23(11-7-21)12-8-22(2)9-13-24-14-15-25(26(20-24)28-3)29-19-18-27-16-4-5-17-27/h6-7,10-11,14-15,20,22H,4-5,8-9,12-13,16-19H2,1-3H3/t22-/m0/s1 |
| InChIKey | PQXLPCKAZABRHK-QFIPXVFZSA-N |
| XLogP | 5.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |