C27H25Cl2F8N5O3 — CID 148959225
2-[2,6-dichloro-3-[(3,3,3-trifluoropropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-N-[4-(trifluoromethyl)cyclohexyl]-3H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 148959225) has the molecular formula C27H25Cl2F8N5O3 and a molecular weight of 690.42 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[(3,3,3-trifluoropropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-N-[4-(trifluoromethyl)cyclohexyl]-3H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 2-[2,6-dichloro-3-[(3,3,3-trifluoropropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-N-[4-(trifluoromethyl)cyclohexyl]-3H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 148959225 |
| Molecular Formula | C27H25Cl2F8N5O3 |
| Molecular Weight | 690.42 g/mol |
| Exact Mass | 689.12 |
| IUPAC Name | 2-[2,6-dichloro-3-[(3,3,3-trifluoropropanoylamino)methyl]anilino]-6-(2,2-difluoroethoxy)-N-[4-(trifluoromethyl)cyclohexyl]-3H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | O=C(CC(F)(F)F)NCc1ccc(Cl)c(NC2=Nc3nc(OCC(F)F)c(C(=O)NC4CCC(C(F)(F)F)CC4)cc3C2)c1Cl |
| InChI | InChI=1S/C27H25Cl2F8N5O3/c28-17-6-1-12(10-38-20(43)9-26(32,33)34)21(29)22(17)40-19-8-13-7-16(25(42-23(13)41-19)45-11-18(30)31)24(44)39-15-4-2-14(3-5-15)27(35,36)37/h1,6-7,14-15,18H,2-5,8-11H2,(H,38,43)(H,39,44)(H,40,41,42) |
| InChIKey | PRMAXYIUUGFMBS-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.42 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |