About [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid
[1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid (PubChem CID 14896490) has the molecular formula C20H24N2O7
and a molecular weight of 404.42 g/mol. Its IUPAC name is [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid.
Molecular Properties
| Compound Name | [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid |
| PubChem CID | 14896490 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid |
| SMILES | CC(=O)N(C)CC#CCN1CCC(OC(=O)c2ccccc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22N2O3.C2H2O4/c1-15(21)19(2)11-6-7-12-20-13-10-17(14-20)23-18(22)16-8-4-3-5-9-16;3-1(4)2(5)6/h3-5,8-9,17H,10-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DWOFIJQXJYJFBF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid?
The IUPAC name of [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid (CID 14896490) is [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid.
What is the SMILES notation for [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid?
The canonical SMILES for [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid is CC(=O)N(C)CC#CCN1CCC(OC(=O)c2ccccc2)C1.O=C(O)C(=O)O.
What is the InChIKey of [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid?
The InChIKey is DWOFIJQXJYJFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O3.C2H2O4/c1-15(21)19(2)11-6-7-12-20-13-10-17(14-20)23-18(22)16-8-4-3-5-9-16;3-1(4)2(5)6/h3-5,8-9,17H,10-14H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid?
[1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid has a molecular weight of 404.42 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-[acetyl(methyl)amino]but-2-ynyl]pyrrolidin-3-yl] benzoate;oxalic acid is sourced from PubChem (CID 14896490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).