C10H11F3O2 — CID 148965171
2,3-difluoro-4-(2-fluorobutoxy)phenol (PubChem CID 148965171) has the molecular formula C10H11F3O2 and a molecular weight of 220.19 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-fluorobutoxy)phenol.
| Compound Name | 2,3-difluoro-4-(2-fluorobutoxy)phenol |
|---|---|
| PubChem CID | 148965171 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,3-difluoro-4-(2-fluorobutoxy)phenol |
| SMILES | CCC(F)COc1ccc(O)c(F)c1F |
| InChI | InChI=1S/C10H11F3O2/c1-2-6(11)5-15-8-4-3-7(14)9(12)10(8)13/h3-4,6,14H,2,5H2,1H3 |
| InChIKey | PSOYYXAGGDFDDN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |