About 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide
2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide (PubChem CID 14896603) has the molecular formula C20H23N3O
and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide.
Molecular Properties
| Compound Name | 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide |
| PubChem CID | 14896603 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C20H23N3O/c1-3-5-7-14(4-2)20(24)23-17-12-11-16-10-9-15-8-6-13-21-18(15)19(16)22-17/h6,8-14H,3-5,7H2,1-2H3,(H,22,23,24) |
| InChIKey | QYJHFXYGSQTQDL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide?
The IUPAC name of 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide (CID 14896603) is 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide.
What is the SMILES notation for 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide?
The canonical SMILES for 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide is CCCCC(CC)C(=O)Nc1ccc2ccc3cccnc3c2n1.
What is the InChIKey of 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide?
The InChIKey is QYJHFXYGSQTQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O/c1-3-5-7-14(4-2)20(24)23-17-12-11-16-10-9-15-8-6-13-21-18(15)19(16)22-17/h6,8-14H,3-5,7H2,1-2H3,(H,22,23,24).
What are the key properties of 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide?
2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide has a molecular weight of 321.42 g/mol, XLogP of 4.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-(1,10-phenanthrolin-2-yl)hexanamide is sourced from PubChem (CID 14896603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).