About N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine
N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine (PubChem CID 14896611) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine |
| PubChem CID | 14896611 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine |
| SMILES | c1ccc(Nc2nc3ccccc3c3nc[nH]c23)cc1 |
| InChI | InChI=1S/C16H12N4/c1-2-6-11(7-3-1)19-16-15-14(17-10-18-15)12-8-4-5-9-13(12)20-16/h1-10H,(H,17,18)(H,19,20) |
| InChIKey | BWQWMNKFCIJEBY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine?
The IUPAC name of N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine (CID 14896611) is N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine.
What is the SMILES notation for N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine?
The canonical SMILES for N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine is c1ccc(Nc2nc3ccccc3c3nc[nH]c23)cc1.
What is the InChIKey of N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine?
The InChIKey is BWQWMNKFCIJEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4/c1-2-6-11(7-3-1)19-16-15-14(17-10-18-15)12-8-4-5-9-13(12)20-16/h1-10H,(H,17,18)(H,19,20).
What are the key properties of N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine?
N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine has a molecular weight of 260.30 g/mol, XLogP of 3.85, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-3H-imidazo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 14896611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).