About (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal
(3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal (PubChem CID 148966515) has the molecular formula C6H12NO3P
and a molecular weight of 177.14 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal.
Molecular Properties
| Compound Name | (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal |
| PubChem CID | 148966515 |
| Molecular Formula | C6H12NO3P |
| Molecular Weight | 177.14 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal |
| SMILES | CC(C)(C=O)[C@H](P)C[N+](=O)[O-] |
| InChI | InChI=1S/C6H12NO3P/c1-6(2,4-8)5(11)3-7(9)10/h4-5H,3,11H2,1-2H3/t5-/m1/s1 |
| InChIKey | PSYFJQRLWWEPFF-RXMQYKEDSA-N |
| XLogP | 0.73 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal?
The IUPAC name of (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal (CID 148966515) is (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal.
What is the SMILES notation for (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal?
The canonical SMILES for (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal is CC(C)(C=O)[C@H](P)C[N+](=O)[O-].
What is the InChIKey of (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal?
The InChIKey is PSYFJQRLWWEPFF-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H12NO3P/c1-6(2,4-8)5(11)3-7(9)10/h4-5H,3,11H2,1-2H3/t5-/m1/s1.
What are the key properties of (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal?
(3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal has a molecular weight of 177.14 g/mol, XLogP of 0.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal is sourced from PubChem (CID 148966515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).