C6H12NO3P — CID 148966515
(3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal (PubChem CID 148966515) has the molecular formula C6H12NO3P and a molecular weight of 177.14 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal.
| Compound Name | (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal |
|---|---|
| PubChem CID | 148966515 |
| Molecular Formula | C6H12NO3P |
| Molecular Weight | 177.14 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (3S)-2,2-dimethyl-4-nitro-3-phosphanylbutanal |
| SMILES | CC(C)(C=O)[C@H](P)C[N+](=O)[O-] |
| InChI | InChI=1S/C6H12NO3P/c1-6(2,4-8)5(11)3-7(9)10/h4-5H,3,11H2,1-2H3/t5-/m1/s1 |
| InChIKey | PSYFJQRLWWEPFF-RXMQYKEDSA-N |
| XLogP | 0.73 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|