C5H9N3O — CID 14896775
1,5-dimethyl-2,5-dihydro-1,2,4-triazin-6-one (PubChem CID 14896775) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is 1,5-dimethyl-2,5-dihydro-1,2,4-triazin-6-one.
| Compound Name | 1,5-dimethyl-2,5-dihydro-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 14896775 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 1,5-dimethyl-2,5-dihydro-1,2,4-triazin-6-one |
| SMILES | CC1N=CNN(C)C1=O |
| InChI | InChI=1S/C5H9N3O/c1-4-5(9)8(2)7-3-6-4/h3-4H,1-2H3,(H,6,7) |
| InChIKey | NFNXAXSHKSXOEZ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |